(5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid

C20H30O3 — CID 5283162

IUPAC(5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid
SMILESCCCCC/C=C\CC(=O)/C=C/C=C\C/C=C\CCCC(=O)O
InChIInChI=1S/C20H30O3/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h7-11,13-14,17H,2-6,12,15-16,18H2,1H3,(H,22,23)/b9-7-,11-8-,13-10-,17-14+
InChIKeyGURBRQGDZZKITB-VXBMJZGYSA-N
MW318.46 g/mol
LogP5.40
Rot. Bonds14

About (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid

(5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid (PubChem CID 5283162) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid.

Molecular Properties

Compound Name(5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid
PubChem CID5283162
Molecular FormulaC20H30O3
Molecular Weight318.46 g/mol
Exact Mass318.22
IUPAC Name(5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid
SMILESCCCCC/C=C\CC(=O)/C=C/C=C\C/C=C\CCCC(=O)O
InChIInChI=1S/C20H30O3/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h7-11,13-14,17H,2-6,12,15-16,18H2,1H3,(H,22,23)/b9-7-,11-8-,13-10-,17-14+
InChIKeyGURBRQGDZZKITB-VXBMJZGYSA-N
XLogP5.40
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds14
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500318.46
LogP ≤ 55.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid?
The IUPAC name of (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid (CID 5283162) is (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid.
What is the SMILES notation for (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid?
The canonical SMILES for (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid is CCCCC/C=C\CC(=O)/C=C/C=C\C/C=C\CCCC(=O)O.
What is the InChIKey of (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid?
The InChIKey is GURBRQGDZZKITB-VXBMJZGYSA-N. The full InChI is InChI=1S/C20H30O3/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h7-11,13-14,17H,2-6,12,15-16,18H2,1H3,(H,22,23)/b9-7-,11-8-,13-10-,17-14+.
What are the key properties of (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid?
(5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid has a molecular weight of 318.46 g/mol, XLogP of 5.40, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoic acid is sourced from PubChem (CID 5283162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).