About (5E)-10-propyltrideca-5,9-dien-1-ol
(5E)-10-propyltrideca-5,9-dien-1-ol (PubChem CID 5283269) has the molecular formula C16H30O
and a molecular weight of 238.41 g/mol. Its IUPAC name is (5E)-10-propyltrideca-5,9-dien-1-ol.
Molecular Properties
| Compound Name | (5E)-10-propyltrideca-5,9-dien-1-ol |
| PubChem CID | 5283269 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (5E)-10-propyltrideca-5,9-dien-1-ol |
| SMILES | CCCC(=CCC/C=C/CCCCO)CCC |
| InChI | InChI=1S/C16H30O/c1-3-12-16(13-4-2)14-10-8-6-5-7-9-11-15-17/h5-6,14,17H,3-4,7-13,15H2,1-2H3/b6-5+ |
| InChIKey | VFBQBIBMXSKCFS-AATRIKPKSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-10-propyltrideca-5,9-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-10-propyltrideca-5,9-dien-1-ol?
The IUPAC name of (5E)-10-propyltrideca-5,9-dien-1-ol (CID 5283269) is (5E)-10-propyltrideca-5,9-dien-1-ol.
What is the SMILES notation for (5E)-10-propyltrideca-5,9-dien-1-ol?
The canonical SMILES for (5E)-10-propyltrideca-5,9-dien-1-ol is CCCC(=CCC/C=C/CCCCO)CCC.
What is the InChIKey of (5E)-10-propyltrideca-5,9-dien-1-ol?
The InChIKey is VFBQBIBMXSKCFS-AATRIKPKSA-N. The full InChI is InChI=1S/C16H30O/c1-3-12-16(13-4-2)14-10-8-6-5-7-9-11-15-17/h5-6,14,17H,3-4,7-13,15H2,1-2H3/b6-5+.
What are the key properties of (5E)-10-propyltrideca-5,9-dien-1-ol?
(5E)-10-propyltrideca-5,9-dien-1-ol has a molecular weight of 238.41 g/mol, XLogP of 5.01, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-10-propyltrideca-5,9-dien-1-ol is sourced from PubChem (CID 5283269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).