About 5-hydroxyhexanal
5-hydroxyhexanal (PubChem CID 5283313) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is 5-hydroxyhexanal.
Molecular Properties
| Compound Name | 5-hydroxyhexanal |
| PubChem CID | 5283313 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 5-hydroxyhexanal |
| SMILES | CC(O)CCCC=O |
| InChI | InChI=1S/C6H12O2/c1-6(8)4-2-3-5-7/h5-6,8H,2-4H2,1H3 |
| InChIKey | YRMUTQRWVGDUBW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxyhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxyhexanal?
The IUPAC name of 5-hydroxyhexanal (CID 5283313) is 5-hydroxyhexanal.
What is the SMILES notation for 5-hydroxyhexanal?
The canonical SMILES for 5-hydroxyhexanal is CC(O)CCCC=O.
What is the InChIKey of 5-hydroxyhexanal?
The InChIKey is YRMUTQRWVGDUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2/c1-6(8)4-2-3-5-7/h5-6,8H,2-4H2,1H3.
What are the key properties of 5-hydroxyhexanal?
5-hydroxyhexanal has a molecular weight of 116.16 g/mol, XLogP of 0.74, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxyhexanal is sourced from PubChem (CID 5283313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).