About (E)-4-hydroxyhex-2-enal
(E)-4-hydroxyhex-2-enal (PubChem CID 5283314) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is (E)-4-hydroxyhex-2-enal.
Molecular Properties
| Compound Name | (E)-4-hydroxyhex-2-enal |
| PubChem CID | 5283314 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (E)-4-hydroxyhex-2-enal |
| SMILES | CCC(O)/C=C/C=O |
| InChI | InChI=1S/C6H10O2/c1-2-6(8)4-3-5-7/h3-6,8H,2H2,1H3/b4-3+ |
| InChIKey | JYTUBIHWMKQZRB-ONEGZZNKSA-N |
| XLogP | 0.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-hydroxyhex-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-hydroxyhex-2-enal?
The IUPAC name of (E)-4-hydroxyhex-2-enal (CID 5283314) is (E)-4-hydroxyhex-2-enal.
What is the SMILES notation for (E)-4-hydroxyhex-2-enal?
The canonical SMILES for (E)-4-hydroxyhex-2-enal is CCC(O)/C=C/C=O.
What is the InChIKey of (E)-4-hydroxyhex-2-enal?
The InChIKey is JYTUBIHWMKQZRB-ONEGZZNKSA-N. The full InChI is InChI=1S/C6H10O2/c1-2-6(8)4-3-5-7/h3-6,8H,2H2,1H3/b4-3+.
What are the key properties of (E)-4-hydroxyhex-2-enal?
(E)-4-hydroxyhex-2-enal has a molecular weight of 114.14 g/mol, XLogP of 0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-hydroxyhex-2-enal is sourced from PubChem (CID 5283314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).