C21H35NO — CID 5283392
(5Z,8Z,11Z,14Z)-N-methylicosa-5,8,11,14-tetraenamide (PubChem CID 5283392) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-methylicosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-methylicosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 5283392 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-methylicosa-5,8,11,14-tetraenamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NC |
| InChI | InChI=1S/C21H35NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(23)22-2/h7-8,10-11,13-14,16-17H,3-6,9,12,15,18-20H2,1-2H3,(H,22,23)/b8-7-,11-10-,14-13-,17-16- |
| InChIKey | HTAWYBRCXMQDBL-ZKWNWVNESA-N |
| XLogP | 5.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|