C25H43NO — CID 5283399
(5Z,8Z,11Z,14Z)-N-(3-methylbutyl)icosa-5,8,11,14-tetraenamide (PubChem CID 5283399) has the molecular formula C25H43NO and a molecular weight of 373.63 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-(3-methylbutyl)icosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-(3-methylbutyl)icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 5283399 |
| Molecular Formula | C25H43NO |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-(3-methylbutyl)icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCC(C)C |
| InChI | InChI=1S/C25H43NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(27)26-23-22-24(2)3/h8-9,11-12,14-15,17-18,24H,4-7,10,13,16,19-23H2,1-3H3,(H,26,27)/b9-8-,12-11-,15-14-,18-17- |
| InChIKey | HKYAUSBRNXNKIW-GKFVBPDJSA-N |
| XLogP | 7.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|