C25H43NO — CID 5283417
N-propyl alpha,alpha-dimethylarachidonoyl amine (PubChem CID 5283417) has the molecular formula C25H43NO and a molecular weight of 373.60 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-2,2-dimethyl-N-propylicosa-5,8,11,14-tetraenamide.
| Compound Name | N-propyl alpha,alpha-dimethylarachidonoyl amine |
|---|---|
| PubChem CID | 5283417 |
| Molecular Formula | C25H43NO |
| Molecular Weight | 373.60 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-2,2-dimethyl-N-propylicosa-5,8,11,14-tetraenamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCC(C)(C)C(=O)NCCC |
| InChI | InChI=1S/C25H43NO/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25(3,4)24(27)26-23-6-2/h10-11,13-14,16-17,19-20H,5-9,12,15,18,21-23H2,1-4H3,(H,26,27)/b11-10-,14-13-,17-16-,20-19- |
| InChIKey | DZZYKVXKTJYUPM-AILJCPQKSA-N |
| XLogP | 7.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | 469 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.60 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|