C27H47NO2 — CID 5283426
(5Z,8Z,11Z,14Z)-N-[(2S)-2-hydroxypropyl]-16,16-dimethyldocosa-5,8,11,14-tetraenamide (PubChem CID 5283426) has the molecular formula C27H47NO2 and a molecular weight of 417.68 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-[(2S)-2-hydroxypropyl]-16,16-dimethyldocosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-[(2S)-2-hydroxypropyl]-16,16-dimethyldocosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 5283426 |
| Molecular Formula | C27H47NO2 |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 417.36 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-[(2S)-2-hydroxypropyl]-16,16-dimethyldocosa-5,8,11,14-tetraenamide |
| SMILES | CCCCCCC(C)(C)/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NC[C@H](C)O |
| InChI | InChI=1S/C27H47NO2/c1-5-6-7-19-22-27(3,4)23-20-17-15-13-11-9-8-10-12-14-16-18-21-26(30)28-24-25(2)29/h8-9,12-15,20,23,25,29H,5-7,10-11,16-19,21-22,24H2,1-4H3,(H,28,30)/b9-8-,14-12-,15-13-,23-20-/t25-/m0/s1 |
| InChIKey | KSNPOSBOLMASTE-ZBPDQRSVSA-N |
| XLogP | 7.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|