C27H47NO — CID 5283428
(5Z,8Z,11Z,14Z)-16,16-dimethyl-N-propyldocosa-5,8,11,14-tetraenamide (PubChem CID 5283428) has the molecular formula C27H47NO and a molecular weight of 401.68 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-16,16-dimethyl-N-propyldocosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-16,16-dimethyl-N-propyldocosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 5283428 |
| Molecular Formula | C27H47NO |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.37 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-16,16-dimethyl-N-propyldocosa-5,8,11,14-tetraenamide |
| SMILES | CCCCCCC(C)(C)/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCC |
| InChI | InChI=1S/C27H47NO/c1-5-7-8-20-23-27(3,4)24-21-18-16-14-12-10-9-11-13-15-17-19-22-26(29)28-25-6-2/h9-10,13-16,21,24H,5-8,11-12,17-20,22-23,25H2,1-4H3,(H,28,29)/b10-9-,15-13-,16-14-,24-21- |
| InChIKey | IRYRMYBLFNDWKY-GWEUNTIUSA-N |
| XLogP | 8.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|