C24H39NO2 — CID 5283433
(5Z,8Z,11Z,14Z)-1-morpholin-4-ylicosa-5,8,11,14-tetraen-1-one (PubChem CID 5283433) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-1-morpholin-4-ylicosa-5,8,11,14-tetraen-1-one.
| Compound Name | (5Z,8Z,11Z,14Z)-1-morpholin-4-ylicosa-5,8,11,14-tetraen-1-one |
|---|---|
| PubChem CID | 5283433 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-1-morpholin-4-ylicosa-5,8,11,14-tetraen-1-one |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(26)25-20-22-27-23-21-25/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-23H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | RUKZVIXSXGGFHW-DOFZRALJSA-N |
| XLogP | 5.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|