C28H48FNO — CID 5283439
(5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2,16,16-trimethyltricosa-5,8,11,14-tetraenamide (PubChem CID 5283439) has the molecular formula C28H48FNO and a molecular weight of 433.70 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2,16,16-trimethyltricosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2,16,16-trimethyltricosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 5283439 |
| Molecular Formula | C28H48FNO |
| Molecular Weight | 433.70 g/mol |
| Exact Mass | 433.37 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2,16,16-trimethyltricosa-5,8,11,14-tetraenamide |
| SMILES | CCCCCCCC(C)(C)/C=C\C/C=C\C/C=C\C/C=C\CCC(C)C(=O)NCCF |
| InChI | InChI=1S/C28H48FNO/c1-5-6-7-16-19-22-28(3,4)23-20-17-14-12-10-8-9-11-13-15-18-21-26(2)27(31)30-25-24-29/h8-9,12-15,20,23,26H,5-7,10-11,16-19,21-22,24-25H2,1-4H3,(H,30,31)/b9-8-,14-12-,15-13-,23-20- |
| InChIKey | FNVGQXLOPHGANI-RPHFINAJSA-N |
| XLogP | 8.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.70 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|