C27H46FNO — CID 5283441
(5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2,17,17-trimethyldocosa-5,8,11,14-tetraenamide (PubChem CID 5283441) has the molecular formula C27H46FNO and a molecular weight of 419.67 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2,17,17-trimethyldocosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2,17,17-trimethyldocosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 5283441 |
| Molecular Formula | C27H46FNO |
| Molecular Weight | 419.67 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2,17,17-trimethyldocosa-5,8,11,14-tetraenamide |
| SMILES | CCCCCC(C)(C)C/C=C\C/C=C\C/C=C\C/C=C\CCC(C)C(=O)NCCF |
| InChI | InChI=1S/C27H46FNO/c1-5-6-18-21-27(3,4)22-19-16-14-12-10-8-7-9-11-13-15-17-20-25(2)26(30)29-24-23-28/h7,9-10,12-13,15-16,19,25H,5-6,8,11,14,17-18,20-24H2,1-4H3,(H,29,30)/b9-7-,12-10-,15-13-,19-16- |
| InChIKey | LCXOKJHEOHVYGG-BYKJYWHHSA-N |
| XLogP | 7.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.67 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|