C26H44FNO — CID 5283443
(5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2-methyltricosa-5,8,11,14-tetraenamide (PubChem CID 5283443) has the molecular formula C26H44FNO and a molecular weight of 405.64 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2-methyltricosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2-methyltricosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 5283443 |
| Molecular Formula | C26H44FNO |
| Molecular Weight | 405.64 g/mol |
| Exact Mass | 405.34 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2-methyltricosa-5,8,11,14-tetraenamide |
| SMILES | CCCCCCCC/C=C\C/C=C\C/C=C\C/C=C\CCC(C)C(=O)NCCF |
| InChI | InChI=1S/C26H44FNO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25(2)26(29)28-24-23-27/h10-11,13-14,16-17,19-20,25H,3-9,12,15,18,21-24H2,1-2H3,(H,28,29)/b11-10-,14-13-,17-16-,20-19- |
| InChIKey | GHGKPXOUKZEHPZ-AILJCPQKSA-N |
| XLogP | 7.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.64 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|