C20H35NO2 — CID 5283445
(6Z,9Z,12Z)-N-(2-hydroxyethyl)octadeca-6,9,12-trienamide (PubChem CID 5283445) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is (6Z,9Z,12Z)-N-(2-hydroxyethyl)octadeca-6,9,12-trienamide.
| Compound Name | (6Z,9Z,12Z)-N-(2-hydroxyethyl)octadeca-6,9,12-trienamide |
|---|---|
| PubChem CID | 5283445 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | (6Z,9Z,12Z)-N-(2-hydroxyethyl)octadeca-6,9,12-trienamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)NCCO |
| InChI | InChI=1S/C20H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22/h6-7,9-10,12-13,22H,2-5,8,11,14-19H2,1H3,(H,21,23)/b7-6-,10-9-,13-12- |
| InChIKey | KRDUNUMTOBLEPM-QNEBEIHSSA-N |
| XLogP | 4.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|