C20H33NO2 — CID 5283448
(6Z,9Z,12Z,15Z)-N-(2-hydroxyethyl)octadeca-6,9,12,15-tetraenamide (PubChem CID 5283448) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (6Z,9Z,12Z,15Z)-N-(2-hydroxyethyl)octadeca-6,9,12,15-tetraenamide.
| Compound Name | (6Z,9Z,12Z,15Z)-N-(2-hydroxyethyl)octadeca-6,9,12,15-tetraenamide |
|---|---|
| PubChem CID | 5283448 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (6Z,9Z,12Z,15Z)-N-(2-hydroxyethyl)octadeca-6,9,12,15-tetraenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)NCCO |
| InChI | InChI=1S/C20H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22/h3-4,6-7,9-10,12-13,22H,2,5,8,11,14-19H2,1H3,(H,21,23)/b4-3-,7-6-,10-9-,13-12- |
| InChIKey | BSEHZAIYCIVZNE-LTKCOYKYSA-N |
| XLogP | 4.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|