C24H41NO2 — CID 5283456
(5Z,8Z,11Z,14Z)-N-(2-hydroxyethyl)-2,2-dimethylicosa-5,8,11,14-tetraenamide (PubChem CID 5283456) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-(2-hydroxyethyl)-2,2-dimethylicosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-(2-hydroxyethyl)-2,2-dimethylicosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 5283456 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-(2-hydroxyethyl)-2,2-dimethylicosa-5,8,11,14-tetraenamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCC(C)(C)C(=O)NCCO |
| InChI | InChI=1S/C24H41NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(2,3)23(27)25-21-22-26/h8-9,11-12,14-15,17-18,26H,4-7,10,13,16,19-22H2,1-3H3,(H,25,27)/b9-8-,12-11-,15-14-,18-17- |
| InChIKey | GATFOXMZJHQECQ-GKFVBPDJSA-N |
| XLogP | 5.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|