C61H104O6 — CID 5283481
[1,1,2,3,3-pentadeuterio-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate (PubChem CID 5283481) has the molecular formula C61H104O6 and a molecular weight of 938.53 g/mol. Its IUPAC name is [1,1,2,3,3-pentadeuterio-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate.
| Compound Name | [1,1,2,3,3-pentadeuterio-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 5283481 |
| Molecular Formula | C61H104O6 |
| Molecular Weight | 938.53 g/mol |
| Exact Mass | 937.81 |
| IUPAC Name | [1,1,2,3,3-pentadeuterio-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate |
| SMILES | [2H]C([2H])(OC(=O)CCCCCCCCC/C=C\C/C=C\CCCCC)C([2H])(OC(=O)CCCC/C=C\C/C=C\C/C=C\CCCCC)C([2H])([2H])OC(=O)CCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C61H104O6/c1-4-7-10-13-16-19-22-25-28-30-33-35-38-41-44-47-50-53-59(62)65-56-58(67-61(64)55-52-49-46-43-40-37-32-27-24-21-18-15-12-9-6-3)57-66-60(63)54-51-48-45-42-39-36-34-31-29-26-23-20-17-14-11-8-5-2/h16-21,25-29,32,40,43,58H,4-15,22-24,30-31,33-39,41-42,44-57H2,1-3H3/b19-16-,20-17-,21-18-,28-25-,29-26-,32-27-,43-40-/i56D2,57D2,58D |
| InChIKey | GHFZWNZLPDAHJI-SCVBJDHBSA-N |
| XLogP | 18.76 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.53 |
| LogP ≤ 5 | 18.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|