About adamantane-2,4-dione
adamantane-2,4-dione (PubChem CID 528350) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is adamantane-2,4-dione.
Molecular Properties
| Compound Name | adamantane-2,4-dione |
| PubChem CID | 528350 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | adamantane-2,4-dione |
| SMILES | O=C1C2CC3CC(C2)C(=O)C1C3 |
| InChI | InChI=1S/C10H12O2/c11-9-6-1-5-2-7(4-6)10(12)8(9)3-5/h5-8H,1-4H2 |
| InChIKey | FSLRANFXEMHCCW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze adamantane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane-2,4-dione?
The IUPAC name of adamantane-2,4-dione (CID 528350) is adamantane-2,4-dione.
What is the SMILES notation for adamantane-2,4-dione?
The canonical SMILES for adamantane-2,4-dione is O=C1C2CC3CC(C2)C(=O)C1C3.
What is the InChIKey of adamantane-2,4-dione?
The InChIKey is FSLRANFXEMHCCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c11-9-6-1-5-2-7(4-6)10(12)8(9)3-5/h5-8H,1-4H2.
What are the key properties of adamantane-2,4-dione?
adamantane-2,4-dione has a molecular weight of 164.20 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane-2,4-dione is sourced from PubChem (CID 528350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).