About 4-ethyl-2,6-dimethyl-1,3,5-dithiazinane
4-ethyl-2,6-dimethyl-1,3,5-dithiazinane (PubChem CID 528360) has the molecular formula C7H15NS2
and a molecular weight of 177.34 g/mol. Its IUPAC name is 4-ethyl-2,6-dimethyl-1,3,5-dithiazinane.
Molecular Properties
| Compound Name | 4-ethyl-2,6-dimethyl-1,3,5-dithiazinane |
| PubChem CID | 528360 |
| Molecular Formula | C7H15NS2 |
| Molecular Weight | 177.34 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 4-ethyl-2,6-dimethyl-1,3,5-dithiazinane |
| SMILES | CCC1NC(C)SC(C)S1 |
| InChI | InChI=1S/C7H15NS2/c1-4-7-8-5(2)9-6(3)10-7/h5-8H,4H2,1-3H3 |
| InChIKey | ZORZRADCTZBZSE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-2,6-dimethyl-1,3,5-dithiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,6-dimethyl-1,3,5-dithiazinane?
The IUPAC name of 4-ethyl-2,6-dimethyl-1,3,5-dithiazinane (CID 528360) is 4-ethyl-2,6-dimethyl-1,3,5-dithiazinane.
What is the SMILES notation for 4-ethyl-2,6-dimethyl-1,3,5-dithiazinane?
The canonical SMILES for 4-ethyl-2,6-dimethyl-1,3,5-dithiazinane is CCC1NC(C)SC(C)S1.
What is the InChIKey of 4-ethyl-2,6-dimethyl-1,3,5-dithiazinane?
The InChIKey is ZORZRADCTZBZSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NS2/c1-4-7-8-5(2)9-6(3)10-7/h5-8H,4H2,1-3H3.
What are the key properties of 4-ethyl-2,6-dimethyl-1,3,5-dithiazinane?
4-ethyl-2,6-dimethyl-1,3,5-dithiazinane has a molecular weight of 177.34 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,6-dimethyl-1,3,5-dithiazinane is sourced from PubChem (CID 528360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).