About 2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide
2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide (PubChem CID 52838881) has the molecular formula C15H12F2N2O4S
and a molecular weight of 354.33 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide |
| PubChem CID | 52838881 |
| Molecular Formula | C15H12F2N2O4S |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide |
| SMILES | O=C1OCCN1c1ccccc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H12F2N2O4S/c16-10-5-6-14(11(17)9-10)24(21,22)18-12-3-1-2-4-13(12)19-7-8-23-15(19)20/h1-6,9,18H,7-8H2 |
| InChIKey | NTYBMMSCLZCEJB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide?
The IUPAC name of 2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide (CID 52838881) is 2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide.
What is the SMILES notation for 2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide?
The canonical SMILES for 2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide is O=C1OCCN1c1ccccc1NS(=O)(=O)c1ccc(F)cc1F.
What is the InChIKey of 2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide?
The InChIKey is NTYBMMSCLZCEJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N2O4S/c16-10-5-6-14(11(17)9-10)24(21,22)18-12-3-1-2-4-13(12)19-7-8-23-15(19)20/h1-6,9,18H,7-8H2.
What are the key properties of 2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide?
2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide has a molecular weight of 354.33 g/mol, XLogP of 2.72, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide is sourced from PubChem (CID 52838881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).