C24H30N2O4S — CID 52839292
(5S)-5-tert-butyl-N-[(S)-cyano-(3,4,5-trimethoxyphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 52839292) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is (5S)-5-tert-butyl-N-[(S)-cyano-(3,4,5-trimethoxyphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5S)-5-tert-butyl-N-[(S)-cyano-(3,4,5-trimethoxyphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 52839292 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (5S)-5-tert-butyl-N-[(S)-cyano-(3,4,5-trimethoxyphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | COc1cc([C@@H](C#N)NC(=O)c2cc3c(s2)CC[C@H](C(C)(C)C)C3)cc(OC)c1OC |
| InChI | InChI=1S/C24H30N2O4S/c1-24(2,3)16-7-8-20-15(9-16)12-21(31-20)23(27)26-17(13-25)14-10-18(28-4)22(30-6)19(11-14)29-5/h10-12,16-17H,7-9H2,1-6H3,(H,26,27)/t16-,17+/m0/s1 |
| InChIKey | ZQMQMYJIOUTKKX-DLBZAZTESA-N |
| XLogP | 4.92 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |