About 2-methyl-4-propyl-1,3-oxazole
2-methyl-4-propyl-1,3-oxazole (PubChem CID 528406) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-methyl-4-propyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-methyl-4-propyl-1,3-oxazole |
| PubChem CID | 528406 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 2-methyl-4-propyl-1,3-oxazole |
| SMILES | CCCc1coc(C)n1 |
| InChI | InChI=1S/C7H11NO/c1-3-4-7-5-9-6(2)8-7/h5H,3-4H2,1-2H3 |
| InChIKey | RNLOKHYLXARFPN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4-propyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-propyl-1,3-oxazole?
The IUPAC name of 2-methyl-4-propyl-1,3-oxazole (CID 528406) is 2-methyl-4-propyl-1,3-oxazole.
What is the SMILES notation for 2-methyl-4-propyl-1,3-oxazole?
The canonical SMILES for 2-methyl-4-propyl-1,3-oxazole is CCCc1coc(C)n1.
What is the InChIKey of 2-methyl-4-propyl-1,3-oxazole?
The InChIKey is RNLOKHYLXARFPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-3-4-7-5-9-6(2)8-7/h5H,3-4H2,1-2H3.
What are the key properties of 2-methyl-4-propyl-1,3-oxazole?
2-methyl-4-propyl-1,3-oxazole has a molecular weight of 125.17 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-propyl-1,3-oxazole is sourced from PubChem (CID 528406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).