About 4-chloroaniline;hydrochloride
4-chloroaniline;hydrochloride (PubChem CID 5284363) has the molecular formula C6H7Cl2N
and a molecular weight of 164.03 g/mol. Its IUPAC name is 4-chloroaniline;hydrochloride.
Molecular Properties
| Compound Name | 4-chloroaniline;hydrochloride |
| PubChem CID | 5284363 |
| Molecular Formula | C6H7Cl2N |
| Molecular Weight | 164.03 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | 4-chloroaniline;hydrochloride |
| SMILES | Cl.Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H6ClN.ClH/c7-5-1-3-6(8)4-2-5;/h1-4H,8H2;1H |
| InChIKey | ISJBQSJDQZLCSF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.03 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloroaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloroaniline;hydrochloride?
The IUPAC name of 4-chloroaniline;hydrochloride (CID 5284363) is 4-chloroaniline;hydrochloride.
What is the SMILES notation for 4-chloroaniline;hydrochloride?
The canonical SMILES for 4-chloroaniline;hydrochloride is Cl.Nc1ccc(Cl)cc1.
What is the InChIKey of 4-chloroaniline;hydrochloride?
The InChIKey is ISJBQSJDQZLCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN.ClH/c7-5-1-3-6(8)4-2-5;/h1-4H,8H2;1H.
What are the key properties of 4-chloroaniline;hydrochloride?
4-chloroaniline;hydrochloride has a molecular weight of 164.03 g/mol, XLogP of 2.34, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloroaniline;hydrochloride is sourced from PubChem (CID 5284363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).