C18H19N3O4 — CID 52844517
3-[[(4S)-4-(2,5-dimethylfuran-3-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzamide (PubChem CID 52844517) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-[[(4S)-4-(2,5-dimethylfuran-3-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzamide.
| Compound Name | 3-[[(4S)-4-(2,5-dimethylfuran-3-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 52844517 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-[[(4S)-4-(2,5-dimethylfuran-3-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzamide |
| SMILES | Cc1cc([C@]2(C)NC(=O)N(Cc3cccc(C(N)=O)c3)C2=O)c(C)o1 |
| InChI | InChI=1S/C18H19N3O4/c1-10-7-14(11(2)25-10)18(3)16(23)21(17(24)20-18)9-12-5-4-6-13(8-12)15(19)22/h4-8H,9H2,1-3H3,(H2,19,22)(H,20,24)/t18-/m0/s1 |
| InChIKey | YTFGOHPBNIQKFR-SFHVURJKSA-N |
| XLogP | 1.96 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|