About 1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine
1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine (PubChem CID 5284474) has the molecular formula C13H13N3
and a molecular weight of 211.27 g/mol. Its IUPAC name is 1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine.
Molecular Properties
| Compound Name | 1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine |
| PubChem CID | 5284474 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine |
| SMILES | Cc1c(N)nc(C)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C13H13N3/c1-7-12-11(8(2)15-13(7)14)9-5-3-4-6-10(9)16-12/h3-6,16H,1-2H3,(H2,14,15) |
| InChIKey | LVTKHGUGBGNBPL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine?
The IUPAC name of 1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine (CID 5284474) is 1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine.
What is the SMILES notation for 1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine?
The canonical SMILES for 1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine is Cc1c(N)nc(C)c2c1[nH]c1ccccc12.
What is the InChIKey of 1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine?
The InChIKey is LVTKHGUGBGNBPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3/c1-7-12-11(8(2)15-13(7)14)9-5-3-4-6-10(9)16-12/h3-6,16H,1-2H3,(H2,14,15).
What are the key properties of 1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine?
1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine has a molecular weight of 211.27 g/mol, XLogP of 2.92, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine is sourced from PubChem (CID 5284474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).