About 4,8,12-trimethyltridec-1-ene
4,8,12-trimethyltridec-1-ene (PubChem CID 528467) has the molecular formula C16H32
and a molecular weight of 224.43 g/mol. Its IUPAC name is 4,8,12-trimethyltridec-1-ene.
Molecular Properties
| Compound Name | 4,8,12-trimethyltridec-1-ene |
| PubChem CID | 528467 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | 4,8,12-trimethyltridec-1-ene |
| SMILES | C=CCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C16H32/c1-6-9-15(4)12-8-13-16(5)11-7-10-14(2)3/h6,14-16H,1,7-13H2,2-5H3 |
| InChIKey | DEQOCZHCEVDSLM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,8,12-trimethyltridec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8,12-trimethyltridec-1-ene?
The IUPAC name of 4,8,12-trimethyltridec-1-ene (CID 528467) is 4,8,12-trimethyltridec-1-ene.
What is the SMILES notation for 4,8,12-trimethyltridec-1-ene?
The canonical SMILES for 4,8,12-trimethyltridec-1-ene is C=CCC(C)CCCC(C)CCCC(C)C.
What is the InChIKey of 4,8,12-trimethyltridec-1-ene?
The InChIKey is DEQOCZHCEVDSLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32/c1-6-9-15(4)12-8-13-16(5)11-7-10-14(2)3/h6,14-16H,1,7-13H2,2-5H3.
What are the key properties of 4,8,12-trimethyltridec-1-ene?
4,8,12-trimethyltridec-1-ene has a molecular weight of 224.43 g/mol, XLogP of 5.83, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8,12-trimethyltridec-1-ene is sourced from PubChem (CID 528467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).