C25H18ClN3OS2 — CID 5284716
(2R,3R,4S)-3-(6-chloroquinolin-1-ium-1-yl)-5-cyano-2-hydroxy-2-phenyl-4-thiophen-3-yl-3,4-dihydro-1H-pyridine-6-thiolate (PubChem CID 5284716) has the molecular formula C25H18ClN3OS2 and a molecular weight of 476.03 g/mol. Its IUPAC name is (2R,3R,4S)-3-(6-chloroquinolin-1-ium-1-yl)-5-cyano-2-hydroxy-2-phenyl-4-thiophen-3-yl-3,4-dihydro-1H-pyridine-6-thiolate.
| Compound Name | (2R,3R,4S)-3-(6-chloroquinolin-1-ium-1-yl)-5-cyano-2-hydroxy-2-phenyl-4-thiophen-3-yl-3,4-dihydro-1H-pyridine-6-thiolate |
|---|---|
| PubChem CID | 5284716 |
| Molecular Formula | C25H18ClN3OS2 |
| Molecular Weight | 476.03 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | (2R,3R,4S)-3-(6-chloroquinolin-1-ium-1-yl)-5-cyano-2-hydroxy-2-phenyl-4-thiophen-3-yl-3,4-dihydro-1H-pyridine-6-thiolate |
| SMILES | N#CC1=C([S-])N[C@@](O)(c2ccccc2)[C@H]([n+]2cccc3cc(Cl)ccc32)[C@H]1c1ccsc1 |
| InChI | InChI=1S/C25H18ClN3OS2/c26-19-8-9-21-16(13-19)5-4-11-29(21)23-22(17-10-12-32-15-17)20(14-27)24(31)28-25(23,30)18-6-2-1-3-7-18/h1-13,15,22-23,28,30H/t22-,23+,25+/m0/s1 |
| InChIKey | MVVRSFFRAZNNJG-JBRSBNLGSA-N |
| XLogP | 4.90 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.03 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|