About 3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile
3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile (PubChem CID 52848171) has the molecular formula C12H8N6O
and a molecular weight of 252.24 g/mol. Its IUPAC name is 3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile.
Molecular Properties
| Compound Name | 3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile |
| PubChem CID | 52848171 |
| Molecular Formula | C12H8N6O |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile |
| SMILES | Cc1cc(C#N)ccc1Oc1ccc2nnnn2n1 |
| InChI | InChI=1S/C12H8N6O/c1-8-6-9(7-13)2-3-10(8)19-12-5-4-11-14-16-17-18(11)15-12/h2-6H,1H3 |
| InChIKey | SBZXIFLNXDYFAU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 88.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile?
The IUPAC name of 3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile (CID 52848171) is 3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile.
What is the SMILES notation for 3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile?
The canonical SMILES for 3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile is Cc1cc(C#N)ccc1Oc1ccc2nnnn2n1.
What is the InChIKey of 3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile?
The InChIKey is SBZXIFLNXDYFAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N6O/c1-8-6-9(7-13)2-3-10(8)19-12-5-4-11-14-16-17-18(11)15-12/h2-6H,1H3.
What are the key properties of 3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile?
3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile has a molecular weight of 252.24 g/mol, XLogP of 1.49, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(tetrazolo[1,5-b]pyridazin-6-yloxy)benzonitrile is sourced from PubChem (CID 52848171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).