C30H64O7Si4 — CID 528571
tris[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxypropane-1,2,3-tricarboxylate (PubChem CID 528571) has the molecular formula C30H64O7Si4 and a molecular weight of 649.18 g/mol. Its IUPAC name is tris[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxypropane-1,2,3-tricarboxylate.
| Compound Name | tris[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 528571 |
| Molecular Formula | C30H64O7Si4 |
| Molecular Weight | 649.18 g/mol |
| Exact Mass | 648.37 |
| IUPAC Name | tris[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxypropane-1,2,3-tricarboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)CC(CC(=O)O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H64O7Si4/c1-26(2,3)38(13,14)34-23(31)21-30(37-41(19,20)29(10,11)12,25(33)36-40(17,18)28(7,8)9)22-24(32)35-39(15,16)27(4,5)6/h21-22H2,1-20H3 |
| InChIKey | LYMHMSBQXFZXLH-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.18 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|