C40H23N3O10 — CID 5285714
2-[3-(5-carboxy-1,3-dioxoisoindol-2-yl)-5-[[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl]carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 5285714) has the molecular formula C40H23N3O10 and a molecular weight of 705.64 g/mol. Its IUPAC name is 2-[3-(5-carboxy-1,3-dioxoisoindol-2-yl)-5-[[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl]carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[3-(5-carboxy-1,3-dioxoisoindol-2-yl)-5-[[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl]carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 5285714 |
| Molecular Formula | C40H23N3O10 |
| Molecular Weight | 705.64 g/mol |
| Exact Mass | 705.14 |
| IUPAC Name | 2-[3-(5-carboxy-1,3-dioxoisoindol-2-yl)-5-[[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl]carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(c1cc(C(=O)Nc3ccc(/C=C/C(=O)c4ccccc4)cc3)cc(N3C(=O)c4ccc(C(=O)O)cc4C3=O)c1)C2=O |
| InChI | InChI=1S/C40H23N3O10/c44-33(22-4-2-1-3-5-22)15-8-21-6-11-26(12-7-21)41-34(45)25-16-27(42-35(46)29-13-9-23(39(50)51)18-31(29)37(42)48)20-28(17-25)43-36(47)30-14-10-24(40(52)53)19-32(30)38(43)49/h1-20H,(H,41,45)(H,50,51)(H,52,53)/b15-8+ |
| InChIKey | WJWRDBNAUIUGIE-OVCLIPMQSA-N |
| XLogP | 5.83 |
| TPSA | 195.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|