C17H29N3O3 — CID 52858703
(2S)-1-N-[(2-ethoxy-5-nitrophenyl)methyl]-2-N,2-N,4-trimethylpentane-1,2-diamine (PubChem CID 52858703) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is (2S)-1-N-[(2-ethoxy-5-nitrophenyl)methyl]-2-N,2-N,4-trimethylpentane-1,2-diamine.
| Compound Name | (2S)-1-N-[(2-ethoxy-5-nitrophenyl)methyl]-2-N,2-N,4-trimethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 52858703 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | (2S)-1-N-[(2-ethoxy-5-nitrophenyl)methyl]-2-N,2-N,4-trimethylpentane-1,2-diamine |
| SMILES | CCOc1ccc([N+](=O)[O-])cc1CNC[C@H](CC(C)C)N(C)C |
| InChI | InChI=1S/C17H29N3O3/c1-6-23-17-8-7-15(20(21)22)10-14(17)11-18-12-16(19(4)5)9-13(2)3/h7-8,10,13,16,18H,6,9,11-12H2,1-5H3/t16-/m0/s1 |
| InChIKey | GZRFSCQMAZJPQJ-INIZCTEOSA-N |
| XLogP | 3.06 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|