About N-propan-2-ylhexanamide
N-propan-2-ylhexanamide (PubChem CID 528620) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is N-propan-2-ylhexanamide.
Molecular Properties
| Compound Name | N-propan-2-ylhexanamide |
| PubChem CID | 528620 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | N-propan-2-ylhexanamide |
| SMILES | CCCCCC(=O)NC(C)C |
| InChI | InChI=1S/C9H19NO/c1-4-5-6-7-9(11)10-8(2)3/h8H,4-7H2,1-3H3,(H,10,11) |
| InChIKey | YVMILMYSJMSHNO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-propan-2-ylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-ylhexanamide?
The IUPAC name of N-propan-2-ylhexanamide (CID 528620) is N-propan-2-ylhexanamide.
What is the SMILES notation for N-propan-2-ylhexanamide?
The canonical SMILES for N-propan-2-ylhexanamide is CCCCCC(=O)NC(C)C.
What is the InChIKey of N-propan-2-ylhexanamide?
The InChIKey is YVMILMYSJMSHNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-4-5-6-7-9(11)10-8(2)3/h8H,4-7H2,1-3H3,(H,10,11).
What are the key properties of N-propan-2-ylhexanamide?
N-propan-2-ylhexanamide has a molecular weight of 157.26 g/mol, XLogP of 2.09, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-ylhexanamide is sourced from PubChem (CID 528620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).