About (4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one
(4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one (PubChem CID 52864052) has the molecular formula C15H22N2O5S2
and a molecular weight of 374.48 g/mol. Its IUPAC name is (4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one |
| PubChem CID | 52864052 |
| Molecular Formula | C15H22N2O5S2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one |
| SMILES | CC(C)N1C[C@H](Nc2ccc(S(C)(=O)=O)cc2S(C)(=O)=O)CC1=O |
| InChI | InChI=1S/C15H22N2O5S2/c1-10(2)17-9-11(7-15(17)18)16-13-6-5-12(23(3,19)20)8-14(13)24(4,21)22/h5-6,8,10-11,16H,7,9H2,1-4H3/t11-/m1/s1 |
| InChIKey | DAHFNPXQWYMMOR-LLVKDONJSA-N |
| XLogP | 0.91 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one?
The IUPAC name of (4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one (CID 52864052) is (4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one.
What is the SMILES notation for (4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one?
The canonical SMILES for (4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one is CC(C)N1C[C@H](Nc2ccc(S(C)(=O)=O)cc2S(C)(=O)=O)CC1=O.
What is the InChIKey of (4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one?
The InChIKey is DAHFNPXQWYMMOR-LLVKDONJSA-N. The full InChI is InChI=1S/C15H22N2O5S2/c1-10(2)17-9-11(7-15(17)18)16-13-6-5-12(23(3,19)20)8-14(13)24(4,21)22/h5-6,8,10-11,16H,7,9H2,1-4H3/t11-/m1/s1.
What are the key properties of (4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one?
(4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one has a molecular weight of 374.48 g/mol, XLogP of 0.91, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[2,4-bis(methylsulfonyl)anilino]-1-propan-2-ylpyrrolidin-2-one is sourced from PubChem (CID 52864052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).