About 2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine
2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine (PubChem CID 52864108) has the molecular formula C13H16F3N3O2
and a molecular weight of 303.28 g/mol. Its IUPAC name is 2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine |
| PubChem CID | 52864108 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1ccnc(N2CCC[C@H](C3OCCO3)C2)n1 |
| InChI | InChI=1S/C13H16F3N3O2/c14-13(15,16)10-3-4-17-12(18-10)19-5-1-2-9(8-19)11-20-6-7-21-11/h3-4,9,11H,1-2,5-8H2/t9-/m0/s1 |
| InChIKey | MODDXVXMXNOVCU-VIFPVBQESA-N |
| XLogP | 2.08 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine?
The IUPAC name of 2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine (CID 52864108) is 2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine?
The canonical SMILES for 2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine is FC(F)(F)c1ccnc(N2CCC[C@H](C3OCCO3)C2)n1.
What is the InChIKey of 2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine?
The InChIKey is MODDXVXMXNOVCU-VIFPVBQESA-N. The full InChI is InChI=1S/C13H16F3N3O2/c14-13(15,16)10-3-4-17-12(18-10)19-5-1-2-9(8-19)11-20-6-7-21-11/h3-4,9,11H,1-2,5-8H2/t9-/m0/s1.
What are the key properties of 2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine?
2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine has a molecular weight of 303.28 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]-4-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 52864108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).