About 3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile
3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile (PubChem CID 5286423) has the molecular formula C14H15N3S
and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile |
| PubChem CID | 5286423 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile |
| SMILES | C/C=C/Cc1c(C)nc2sc(C#N)c(N)c2c1C |
| InChI | InChI=1S/C14H15N3S/c1-4-5-6-10-8(2)12-13(16)11(7-15)18-14(12)17-9(10)3/h4-5H,6,16H2,1-3H3/b5-4+ |
| InChIKey | MKTGIKNCDZQQNY-SNAWJCMRSA-N |
| XLogP | 3.49 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile?
The IUPAC name of 3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile (CID 5286423) is 3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile.
What is the SMILES notation for 3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile?
The canonical SMILES for 3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile is C/C=C/Cc1c(C)nc2sc(C#N)c(N)c2c1C.
What is the InChIKey of 3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile?
The InChIKey is MKTGIKNCDZQQNY-SNAWJCMRSA-N. The full InChI is InChI=1S/C14H15N3S/c1-4-5-6-10-8(2)12-13(16)11(7-15)18-14(12)17-9(10)3/h4-5H,6,16H2,1-3H3/b5-4+.
What are the key properties of 3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile?
3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile has a molecular weight of 257.36 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-[(E)-but-2-enyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile is sourced from PubChem (CID 5286423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).