trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate

C13H32O4Si3 — CID 528646

IUPACtrimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate
SMILESC[Si](C)(C)OCCC(O[Si](C)(C)C)C(=O)O[Si](C)(C)C
InChIInChI=1S/C13H32O4Si3/c1-18(2,3)15-11-10-12(16-19(4,5)6)13(14)17-20(7,8)9/h12H,10-11H2,1-9H3
InChIKeyLVLAUUNRZLEVPB-UHFFFAOYSA-N
MW336.65 g/mol
LogP3.83
Rot. Bonds8

About trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate

trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate (PubChem CID 528646) has the molecular formula C13H32O4Si3 and a molecular weight of 336.65 g/mol. Its IUPAC name is trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate.

Molecular Properties

Compound Nametrimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate
PubChem CID528646
Molecular FormulaC13H32O4Si3
Molecular Weight336.65 g/mol
Exact Mass336.16
IUPAC Nametrimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate
SMILESC[Si](C)(C)OCCC(O[Si](C)(C)C)C(=O)O[Si](C)(C)C
InChIInChI=1S/C13H32O4Si3/c1-18(2,3)15-11-10-12(16-19(4,5)6)13(14)17-20(7,8)9/h12H,10-11H2,1-9H3
InChIKeyLVLAUUNRZLEVPB-UHFFFAOYSA-N
XLogP3.83
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500336.65
LogP ≤ 53.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate?
The IUPAC name of trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate (CID 528646) is trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate.
What is the SMILES notation for trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate?
The canonical SMILES for trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate is C[Si](C)(C)OCCC(O[Si](C)(C)C)C(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate?
The InChIKey is LVLAUUNRZLEVPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H32O4Si3/c1-18(2,3)15-11-10-12(16-19(4,5)6)13(14)17-20(7,8)9/h12H,10-11H2,1-9H3.
What are the key properties of trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate?
trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate has a molecular weight of 336.65 g/mol, XLogP of 3.83, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 2,4-bis(trimethylsilyloxy)butanoate is sourced from PubChem (CID 528646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).