About N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide
N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide (PubChem CID 5286593) has the molecular formula C21H26N2O2
and a molecular weight of 338.45 g/mol. Its IUPAC name is N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide.
Molecular Properties
| Compound Name | N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide |
| PubChem CID | 5286593 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide |
| SMILES | O=C(NNC(=O)C12CC3CC(CC(C3)C1)C2)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c24-19(18-9-17(18)16-4-2-1-3-5-16)22-23-20(25)21-10-13-6-14(11-21)8-15(7-13)12-21/h1-5,13-15,17-18H,6-12H2,(H,22,24)(H,23,25)/t13?,14?,15?,17-,18+,21?/m0/s1 |
| InChIKey | PIPKSJQWWUXIRL-DGSGAQMOSA-N |
| XLogP | 3.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide?
The IUPAC name of N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide (CID 5286593) is N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide.
What is the SMILES notation for N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide?
The canonical SMILES for N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide is O=C(NNC(=O)C12CC3CC(CC(C3)C1)C2)[C@@H]1C[C@H]1c1ccccc1.
What is the InChIKey of N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide?
The InChIKey is PIPKSJQWWUXIRL-DGSGAQMOSA-N. The full InChI is InChI=1S/C21H26N2O2/c24-19(18-9-17(18)16-4-2-1-3-5-16)22-23-20(25)21-10-13-6-14(11-21)8-15(7-13)12-21/h1-5,13-15,17-18H,6-12H2,(H,22,24)(H,23,25)/t13?,14?,15?,17-,18+,21?/m0/s1.
What are the key properties of N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide?
N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide has a molecular weight of 338.45 g/mol, XLogP of 3.15, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(1R,2R)-2-phenylcyclopropanecarbonyl]adamantane-1-carbohydrazide is sourced from PubChem (CID 5286593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).