About (3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one
(3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one (PubChem CID 5286775) has the molecular formula C23H16N2O3
and a molecular weight of 368.39 g/mol. Its IUPAC name is (3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one.
Molecular Properties
| Compound Name | (3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one |
| PubChem CID | 5286775 |
| Molecular Formula | C23H16N2O3 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one |
| SMILES | O=C1/C(=C/c2ccc([N+](=O)[O-])cc2)C=C(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C23H16N2O3/c26-23-19(15-17-11-13-21(14-12-17)25(27)28)16-22(18-7-3-1-4-8-18)24(23)20-9-5-2-6-10-20/h1-16H/b19-15+ |
| InChIKey | SVFZZGMEUFFNTC-XDJHFCHBSA-N |
| XLogP | 5.07 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one?
The IUPAC name of (3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one (CID 5286775) is (3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one.
What is the SMILES notation for (3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one?
The canonical SMILES for (3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one is O=C1/C(=C/c2ccc([N+](=O)[O-])cc2)C=C(c2ccccc2)N1c1ccccc1.
What is the InChIKey of (3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one?
The InChIKey is SVFZZGMEUFFNTC-XDJHFCHBSA-N. The full InChI is InChI=1S/C23H16N2O3/c26-23-19(15-17-11-13-21(14-12-17)25(27)28)16-22(18-7-3-1-4-8-18)24(23)20-9-5-2-6-10-20/h1-16H/b19-15+.
What are the key properties of (3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one?
(3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one has a molecular weight of 368.39 g/mol, XLogP of 5.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(4-nitrophenyl)methylidene]-1,5-diphenylpyrrol-2-one is sourced from PubChem (CID 5286775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).