C25H21NO2 — CID 5286883
[[(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino] 4-methylbenzoate (PubChem CID 5286883) has the molecular formula C25H21NO2 and a molecular weight of 367.45 g/mol. Its IUPAC name is [[(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino] 4-methylbenzoate.
| Compound Name | [[(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino] 4-methylbenzoate |
|---|---|
| PubChem CID | 5286883 |
| Molecular Formula | C25H21NO2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [[(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)ON=C(/C=C/c2ccccc2)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21NO2/c1-20-12-16-23(17-13-20)25(27)28-26-24(18-14-21-8-4-2-5-9-21)19-15-22-10-6-3-7-11-22/h2-19H,1H3/b18-14+,19-15+ |
| InChIKey | YEKRYLJMWPUKCG-JSAVKQRWSA-N |
| XLogP | 5.93 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|