About 2-ethyl-1,3,4-trimethylbenzene
2-ethyl-1,3,4-trimethylbenzene (PubChem CID 528692) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is 2-ethyl-1,3,4-trimethylbenzene.
Molecular Properties
| Compound Name | 2-ethyl-1,3,4-trimethylbenzene |
| PubChem CID | 528692 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 2-ethyl-1,3,4-trimethylbenzene |
| SMILES | CCc1c(C)ccc(C)c1C |
| InChI | InChI=1S/C11H16/c1-5-11-9(3)7-6-8(2)10(11)4/h6-7H,5H2,1-4H3 |
| InChIKey | KQRPSLILDAZZMH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-ethyl-1,3,4-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,3,4-trimethylbenzene?
The IUPAC name of 2-ethyl-1,3,4-trimethylbenzene (CID 528692) is 2-ethyl-1,3,4-trimethylbenzene.
What is the SMILES notation for 2-ethyl-1,3,4-trimethylbenzene?
The canonical SMILES for 2-ethyl-1,3,4-trimethylbenzene is CCc1c(C)ccc(C)c1C.
What is the InChIKey of 2-ethyl-1,3,4-trimethylbenzene?
The InChIKey is KQRPSLILDAZZMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16/c1-5-11-9(3)7-6-8(2)10(11)4/h6-7H,5H2,1-4H3.
What are the key properties of 2-ethyl-1,3,4-trimethylbenzene?
2-ethyl-1,3,4-trimethylbenzene has a molecular weight of 148.25 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,3,4-trimethylbenzene is sourced from PubChem (CID 528692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).