C23H13ClF3NOS3 — CID 5287018
(5E)-5-[[2-(4-chlorophenyl)sulfanylphenyl]methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 5287018) has the molecular formula C23H13ClF3NOS3 and a molecular weight of 508.01 g/mol. Its IUPAC name is (5E)-5-[[2-(4-chlorophenyl)sulfanylphenyl]methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-(4-chlorophenyl)sulfanylphenyl]methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5287018 |
| Molecular Formula | C23H13ClF3NOS3 |
| Molecular Weight | 508.01 g/mol |
| Exact Mass | 506.98 |
| IUPAC Name | (5E)-5-[[2-(4-chlorophenyl)sulfanylphenyl]methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccccc2Sc2ccc(Cl)cc2)SC(=S)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H13ClF3NOS3/c24-16-8-10-18(11-9-16)31-19-7-2-1-4-14(19)12-20-21(29)28(22(30)32-20)17-6-3-5-15(13-17)23(25,26)27/h1-13H/b20-12+ |
| InChIKey | HXNIPOJCDGEFKL-UDWIEESQSA-N |
| XLogP | 7.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.01 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|