About 3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one
3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one (PubChem CID 5287157) has the molecular formula C16H9N3O
and a molecular weight of 259.27 g/mol. Its IUPAC name is 3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one.
Molecular Properties
| Compound Name | 3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one |
| PubChem CID | 5287157 |
| Molecular Formula | C16H9N3O |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one |
| SMILES | O=C1c2ccccc2-c2nnc(-c3ccccn3)cc21 |
| InChI | InChI=1S/C16H9N3O/c20-16-11-6-2-1-5-10(11)15-12(16)9-14(18-19-15)13-7-3-4-8-17-13/h1-9H |
| InChIKey | RYKZFLNYPLAFIE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one?
The IUPAC name of 3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one (CID 5287157) is 3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one.
What is the SMILES notation for 3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one?
The canonical SMILES for 3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one is O=C1c2ccccc2-c2nnc(-c3ccccn3)cc21.
What is the InChIKey of 3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one?
The InChIKey is RYKZFLNYPLAFIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9N3O/c20-16-11-6-2-1-5-10(11)15-12(16)9-14(18-19-15)13-7-3-4-8-17-13/h1-9H.
What are the key properties of 3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one?
3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one has a molecular weight of 259.27 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-2-ylindeno[1,2-c]pyridazin-5-one is sourced from PubChem (CID 5287157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).