C29H41F6NO3Si2 — CID 528732
N-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 528732) has the molecular formula C29H41F6NO3Si2 and a molecular weight of 621.81 g/mol. Its IUPAC name is N-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 528732 |
| Molecular Formula | C29H41F6NO3Si2 |
| Molecular Weight | 621.81 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | N-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CCNC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H41F6NO3Si2/c1-26(2,3)40(7,8)38-23-12-11-19(15-24(23)39-41(9,10)27(4,5)6)13-14-36-25(37)20-16-21(28(30,31)32)18-22(17-20)29(33,34)35/h11-12,15-18H,13-14H2,1-10H3,(H,36,37) |
| InChIKey | JMLSSKPCWIHELM-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.81 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|