C16H25N3O7S2 — CID 5287415
(2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-(methanesulfonamido)pyrrolidine-2-carboxamide (PubChem CID 5287415) has the molecular formula C16H25N3O7S2 and a molecular weight of 435.52 g/mol. Its IUPAC name is (2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-(methanesulfonamido)pyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-(methanesulfonamido)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 5287415 |
| Molecular Formula | C16H25N3O7S2 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-(methanesulfonamido)pyrrolidine-2-carboxamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2C[C@@H](NS(C)(=O)=O)C[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C16H25N3O7S2/c1-3-4-9-26-13-5-7-14(8-6-13)28(24,25)19-11-12(18-27(2,22)23)10-15(19)16(20)17-21/h5-8,12,15,18,21H,3-4,9-11H2,1-2H3,(H,17,20)/t12-,15+/m0/s1 |
| InChIKey | ULDXUWXTVRRUND-SWLSCSKDSA-N |
| XLogP | 0.05 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|