C40H38FeN4O4 — CID 5287448
3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-10-phenyl-7,8-dihydroporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+) (PubChem CID 5287448) has the molecular formula C40H38FeN4O4 and a molecular weight of 694.61 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-10-phenyl-7,8-dihydroporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+).
| Compound Name | 3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-10-phenyl-7,8-dihydroporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+) |
|---|---|
| PubChem CID | 5287448 |
| Molecular Formula | C40H38FeN4O4 |
| Molecular Weight | 694.61 g/mol |
| Exact Mass | 694.22 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-10-phenyl-7,8-dihydroporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+) |
| SMILES | C=Cc1c(C)c2cc3nc(cc4[n-]c(cc5nc(c(-c6ccccc6)c1[n-]2)C(C)C5C=C)c(C)c4CCC(=O)O)C(CCC(=O)O)=C3C.[Fe+2] |
| InChI | InChI=1S/C40H40N4O4.Fe/c1-7-26-24(6)39-38(25-12-10-9-11-13-25)40-27(8-2)21(3)32(43-40)18-30-22(4)28(14-16-36(45)46)34(41-30)20-35-29(15-17-37(47)48)23(5)31(42-35)19-33(26)44-39;/h7-13,18-20,24,26H,1-2,14-17H2,3-6H3,(H4,41,42,43,44,45,46,47,48);/q;+2/p-2 |
| InChIKey | ODMHOWCUYFSODS-UHFFFAOYSA-L |
| XLogP | 8.38 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.61 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|