About 4,6-dimethyl-2-pentyl-1,3,5-dithiazinane
4,6-dimethyl-2-pentyl-1,3,5-dithiazinane (PubChem CID 528750) has the molecular formula C10H21NS2
and a molecular weight of 219.42 g/mol. Its IUPAC name is 4,6-dimethyl-2-pentyl-1,3,5-dithiazinane.
Molecular Properties
| Compound Name | 4,6-dimethyl-2-pentyl-1,3,5-dithiazinane |
| PubChem CID | 528750 |
| Molecular Formula | C10H21NS2 |
| Molecular Weight | 219.42 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 4,6-dimethyl-2-pentyl-1,3,5-dithiazinane |
| SMILES | CCCCCC1SC(C)NC(C)S1 |
| InChI | InChI=1S/C10H21NS2/c1-4-5-6-7-10-12-8(2)11-9(3)13-10/h8-11H,4-7H2,1-3H3 |
| InChIKey | MOQYJFGRWHTLRP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethyl-2-pentyl-1,3,5-dithiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-2-pentyl-1,3,5-dithiazinane?
The IUPAC name of 4,6-dimethyl-2-pentyl-1,3,5-dithiazinane (CID 528750) is 4,6-dimethyl-2-pentyl-1,3,5-dithiazinane.
What is the SMILES notation for 4,6-dimethyl-2-pentyl-1,3,5-dithiazinane?
The canonical SMILES for 4,6-dimethyl-2-pentyl-1,3,5-dithiazinane is CCCCCC1SC(C)NC(C)S1.
What is the InChIKey of 4,6-dimethyl-2-pentyl-1,3,5-dithiazinane?
The InChIKey is MOQYJFGRWHTLRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NS2/c1-4-5-6-7-10-12-8(2)11-9(3)13-10/h8-11H,4-7H2,1-3H3.
What are the key properties of 4,6-dimethyl-2-pentyl-1,3,5-dithiazinane?
4,6-dimethyl-2-pentyl-1,3,5-dithiazinane has a molecular weight of 219.42 g/mol, XLogP of 3.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-2-pentyl-1,3,5-dithiazinane is sourced from PubChem (CID 528750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).