About 2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole
2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole (PubChem CID 52875281) has the molecular formula C11H12ClN5S2
and a molecular weight of 313.84 g/mol. Its IUPAC name is 2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole |
| PubChem CID | 52875281 |
| Molecular Formula | C11H12ClN5S2 |
| Molecular Weight | 313.84 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole |
| SMILES | Cc1nc(Cl)cc(Sc2nnc(N3CCCC3)s2)n1 |
| InChI | InChI=1S/C11H12ClN5S2/c1-7-13-8(12)6-9(14-7)18-11-16-15-10(19-11)17-4-2-3-5-17/h6H,2-5H2,1H3 |
| InChIKey | GNOHIZDPWRUMCF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole?
The IUPAC name of 2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole (CID 52875281) is 2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole.
What is the SMILES notation for 2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole?
The canonical SMILES for 2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole is Cc1nc(Cl)cc(Sc2nnc(N3CCCC3)s2)n1.
What is the InChIKey of 2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole?
The InChIKey is GNOHIZDPWRUMCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN5S2/c1-7-13-8(12)6-9(14-7)18-11-16-15-10(19-11)17-4-2-3-5-17/h6H,2-5H2,1H3.
What are the key properties of 2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole?
2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole has a molecular weight of 313.84 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-2-methylpyrimidin-4-yl)sulfanyl-5-pyrrolidin-1-yl-1,3,4-thiadiazole is sourced from PubChem (CID 52875281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).