C43H38N8O5 — CID 5287793
1,3-bis[2-[(8S)-4-hydroxy-1,8-dimethyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-6-carbonyl]-1H-indol-5-yl]urea (PubChem CID 5287793) has the molecular formula C43H38N8O5 and a molecular weight of 746.83 g/mol. Its IUPAC name is 1,3-bis[2-[(8S)-4-hydroxy-1,8-dimethyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-6-carbonyl]-1H-indol-5-yl]urea.
| Compound Name | 1,3-bis[2-[(8S)-4-hydroxy-1,8-dimethyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-6-carbonyl]-1H-indol-5-yl]urea |
|---|---|
| PubChem CID | 5287793 |
| Molecular Formula | C43H38N8O5 |
| Molecular Weight | 746.83 g/mol |
| Exact Mass | 746.30 |
| IUPAC Name | 1,3-bis[2-[(8S)-4-hydroxy-1,8-dimethyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-6-carbonyl]-1H-indol-5-yl]urea |
| SMILES | Cc1c[nH]c2c(O)cc3c(c12)[C@H](C)CN3C(=O)c1cc2cc(NC(=O)Nc3ccc4[nH]c(C(=O)N5C[C@@H](C)c6c5cc(O)c5[nH]cc(C)c65)cc4c3)ccc2[nH]1 |
| InChI | InChI=1S/C43H38N8O5/c1-19-15-44-39-33(52)13-31-35(37(19)39)21(3)17-50(31)41(54)29-11-23-9-25(5-7-27(23)48-29)46-43(56)47-26-6-8-28-24(10-26)12-30(49-28)42(55)51-18-22(4)36-32(51)14-34(53)40-38(36)20(2)16-45-40/h5-16,21-22,44-45,48-49,52-53H,17-18H2,1-4H3,(H2,46,47,56)/t21-,22-/m1/s1 |
| InChIKey | OAOMXBKMJIBOHZ-FGZHOGPDSA-N |
| XLogP | 8.81 |
| TPSA | 185.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.83 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |