C29H37N7O5S — CID 5287923
2-[(1S,2S)-5-(diaminomethylideneamino)-1-hydroxy-2-[[(2S)-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentyl]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 5287923) has the molecular formula C29H37N7O5S and a molecular weight of 595.73 g/mol. Its IUPAC name is 2-[(1S,2S)-5-(diaminomethylideneamino)-1-hydroxy-2-[[(2S)-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentyl]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[(1S,2S)-5-(diaminomethylideneamino)-1-hydroxy-2-[[(2S)-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentyl]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 5287923 |
| Molecular Formula | C29H37N7O5S |
| Molecular Weight | 595.73 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 2-[(1S,2S)-5-(diaminomethylideneamino)-1-hydroxy-2-[[(2S)-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentyl]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | CN[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)[C@H](O)c1nc2ccc(C(=O)O)cc2s1 |
| InChI | InChI=1S/C29H37N7O5S/c1-32-21(15-17-7-3-2-4-8-17)27(39)36-14-6-10-22(36)25(38)34-20(9-5-13-33-29(30)31)24(37)26-35-19-12-11-18(28(40)41)16-23(19)42-26/h2-4,7-8,11-12,16,20-22,24,32,37H,5-6,9-10,13-15H2,1H3,(H,34,38)(H,40,41)(H4,30,31,33)/t20-,21+,22-,24-/m0/s1 |
| InChIKey | UQSSDGBTOFYFKD-KHUIQGCPSA-N |
| XLogP | 1.39 |
| TPSA | 196.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.73 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|