C22H29N5O5S — CID 5287928
(5S)-N-[(4-aminocyclohexyl)methyl]-2-[2-(benzenesulfonyl)ethyl]-1,3-dioxo-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-5-carboxamide (PubChem CID 5287928) has the molecular formula C22H29N5O5S and a molecular weight of 475.57 g/mol. Its IUPAC name is (5S)-N-[(4-aminocyclohexyl)methyl]-2-[2-(benzenesulfonyl)ethyl]-1,3-dioxo-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-5-carboxamide.
| Compound Name | (5S)-N-[(4-aminocyclohexyl)methyl]-2-[2-(benzenesulfonyl)ethyl]-1,3-dioxo-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-5-carboxamide |
|---|---|
| PubChem CID | 5287928 |
| Molecular Formula | C22H29N5O5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (5S)-N-[(4-aminocyclohexyl)methyl]-2-[2-(benzenesulfonyl)ethyl]-1,3-dioxo-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-5-carboxamide |
| SMILES | NC1CCC(CNC(=O)[C@@H]2C=CCn3c(=O)n(CCS(=O)(=O)c4ccccc4)c(=O)n32)CC1 |
| InChI | InChI=1S/C22H29N5O5S/c23-17-10-8-16(9-11-17)15-24-20(28)19-7-4-12-26-21(29)25(22(30)27(19)26)13-14-33(31,32)18-5-2-1-3-6-18/h1-7,16-17,19H,8-15,23H2,(H,24,28)/t16?,17?,19-/m0/s1 |
| InChIKey | PTMIAKQUJFKTNB-TVPLGVNVSA-N |
| XLogP | 0.03 |
| TPSA | 138.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|